C14H19ClN4OS — CID 66463211
2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]butanethioamide (PubChem CID 66463211) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 66463211 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(C(=O)c2ccncc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN4OS/c1-2-12(13(16)21)18-5-7-19(8-6-18)14(20)10-3-4-17-9-11(10)15/h3-4,9,12H,2,5-8H2,1H3,(H2,16,21) |
| InChIKey | MDISQOZUKPTJPI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|