C13H16ClN3O3 — CID 66462597
3-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]propanoic acid (PubChem CID 66462597) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 66462597 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C(=O)c2ccncc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClN3O3/c14-11-9-15-3-1-10(11)13(20)17-7-5-16(6-8-17)4-2-12(18)19/h1,3,9H,2,4-8H2,(H,18,19) |
| InChIKey | VHHWWVXDWYHKME-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |