C17H22ClN5O3 — CID 154918701
(3-chloro-4-pyridinyl)-[4-[(2-methylpyrazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154918701) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-[4-[(2-methylpyrazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (3-chloro-4-pyridinyl)-[4-[(2-methylpyrazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154918701 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (3-chloro-4-pyridinyl)-[4-[(2-methylpyrazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | Cn1nccc1CN1CCCN(C(=O)c2ccncc2Cl)CC1.O=CO |
| InChI | InChI=1S/C16H20ClN5O.CH2O2/c1-20-13(3-6-19-20)12-21-7-2-8-22(10-9-21)16(23)14-4-5-18-11-15(14)17;2-1-3/h3-6,11H,2,7-10,12H2,1H3;1H,(H,2,3) |
| InChIKey | ILZSXCWPKAGFSP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|