C18H18ClF2N3O — CID 70724703
(2-chloro-4,5-difluorophenyl)-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 70724703) has the molecular formula C18H18ClF2N3O and a molecular weight of 365.81 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 70724703 |
| Molecular Formula | C18H18ClF2N3O |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[4-(pyridin-4-ylmethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C18H18ClF2N3O/c19-15-11-17(21)16(20)10-14(15)18(25)24-7-1-6-23(8-9-24)12-13-2-4-22-5-3-13/h2-5,10-11H,1,6-9,12H2 |
| InChIKey | QXOVJPOFWPCURX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|