C15H16ClN3O2 — CID 106686183
(2-chlorofuran-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone (PubChem CID 106686183) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (2-chlorofuran-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 106686183 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2-chlorofuran-3-yl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1Cl)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-14-13(3-10-21-14)15(20)19-8-6-18(7-9-19)11-12-1-4-17-5-2-12/h1-5,10H,6-9,11H2 |
| InChIKey | ADDLZUONWQFKLD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |