C18H22ClN5O4 — CID 154918620
4-[[4-(3-chloropyridine-4-carbonyl)-1,4-diazepan-1-yl]methyl]-2-methyl-1H-pyrimidin-6-one;formic acid (PubChem CID 154918620) has the molecular formula C18H22ClN5O4 and a molecular weight of 407.86 g/mol. Its IUPAC name is 4-[[4-(3-chloropyridine-4-carbonyl)-1,4-diazepan-1-yl]methyl]-2-methyl-1H-pyrimidin-6-one;formic acid.
| Compound Name | 4-[[4-(3-chloropyridine-4-carbonyl)-1,4-diazepan-1-yl]methyl]-2-methyl-1H-pyrimidin-6-one;formic acid |
|---|---|
| PubChem CID | 154918620 |
| Molecular Formula | C18H22ClN5O4 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[[4-(3-chloropyridine-4-carbonyl)-1,4-diazepan-1-yl]methyl]-2-methyl-1H-pyrimidin-6-one;formic acid |
| SMILES | Cc1nc(CN2CCCN(C(=O)c3ccncc3Cl)CC2)cc(=O)[nH]1.O=CO |
| InChI | InChI=1S/C17H20ClN5O2.CH2O2/c1-12-20-13(9-16(24)21-12)11-22-5-2-6-23(8-7-22)17(25)14-3-4-19-10-15(14)18;2-1-3/h3-4,9-10H,2,5-8,11H2,1H3,(H,20,21,24);1H,(H,2,3) |
| InChIKey | CAHFRSARYFEEDR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|