C13H16ClN3O3 — CID 66482573
methyl 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]acetate (PubChem CID 66482573) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is methyl 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 66482573 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | methyl 2-[4-(3-chloropyridine-4-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)c2ccncc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClN3O3/c1-20-12(18)9-16-4-6-17(7-5-16)13(19)10-2-3-15-8-11(10)14/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | OMSIYOJRGMPFTL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |