C12H14ClN3O3 — CID 114036479
2-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]acetic acid (PubChem CID 114036479) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 114036479 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[4-(4-chloropyridine-3-carbonyl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(C(=O)c2cnccc2Cl)CC1 |
| InChI | InChI=1S/C12H14ClN3O3/c13-10-1-2-14-7-9(10)12(19)16-5-3-15(4-6-16)8-11(17)18/h1-2,7H,3-6,8H2,(H,17,18) |
| InChIKey | SBFFMBOBWUIELY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |