C12H15ClN2O2 — CID 81225158
(4-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 81225158) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is (4-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 81225158 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (4-chloro-3-pyridinyl)-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cnccc1Cl)N1CCC(CO)CC1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-11-1-4-14-7-10(11)12(17)15-5-2-9(8-16)3-6-15/h1,4,7,9,16H,2-3,5-6,8H2 |
| InChIKey | ICPBXTIUYPNVKI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |