C13H25N3O2S — CID 83041982
2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]pentanoic acid (PubChem CID 83041982) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]pentanoic acid.
| Compound Name | 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 83041982 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CCN(C(CC)C(N)=S)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-3-5-11(13(17)18)16-8-6-15(7-9-16)10(4-2)12(14)19/h10-11H,3-9H2,1-2H3,(H2,14,19)(H,17,18) |
| InChIKey | BQMMEBGANGLPID-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|