C10H20N4OS — CID 63341842
2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]acetamide (PubChem CID 63341842) has the molecular formula C10H20N4OS and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]acetamide.
| Compound Name | 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 63341842 |
| Molecular Formula | C10H20N4OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]acetamide |
| SMILES | CCC(C(N)=S)N1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C10H20N4OS/c1-2-8(10(12)16)14-5-3-13(4-6-14)7-9(11)15/h8H,2-7H2,1H3,(H2,11,15)(H2,12,16) |
| InChIKey | YQMXYJRRHWBLOQ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|