C13H27N3OS — CID 79356102
2-[4-(3-hydroxy-3-methylbutyl)piperazin-1-yl]butanethioamide (PubChem CID 79356102) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-3-methylbutyl)piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-(3-hydroxy-3-methylbutyl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 79356102 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 2-[4-(3-hydroxy-3-methylbutyl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(CCC(C)(C)O)CC1 |
| InChI | InChI=1S/C13H27N3OS/c1-4-11(12(14)18)16-9-7-15(8-10-16)6-5-13(2,3)17/h11,17H,4-10H2,1-3H3,(H2,14,18) |
| InChIKey | LKUQNGXDZWDGSV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|