C14H26N4OS — CID 63341711
3-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide (PubChem CID 63341711) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 3-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 63341711 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 3-[4-(1-amino-1-sulfanylidenebutan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide |
| SMILES | CCC(C(N)=S)N1CCN(CCC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C14H26N4OS/c1-2-12(14(15)20)18-9-7-17(8-10-18)6-5-13(19)16-11-3-4-11/h11-12H,2-10H2,1H3,(H2,15,20)(H,16,19) |
| InChIKey | SRXNFBOCPORWML-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|