C15H28N4OS — CID 63341629
2-[4-(1-amino-1-sulfanylidenepentan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide (PubChem CID 63341629) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 2-[4-(1-amino-1-sulfanylidenepentan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide.
| Compound Name | 2-[4-(1-amino-1-sulfanylidenepentan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 63341629 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[4-(1-amino-1-sulfanylidenepentan-2-yl)piperazin-1-yl]-N-cyclopropylpropanamide |
| SMILES | CCCC(C(N)=S)N1CCN(C(C)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C15H28N4OS/c1-3-4-13(14(16)21)19-9-7-18(8-10-19)11(2)15(20)17-12-5-6-12/h11-13H,3-10H2,1-2H3,(H2,16,21)(H,17,20) |
| InChIKey | NBANQAYFNUESKV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|