C15H31N3OS — CID 103033744
2-[4-(3-methoxy-3-methylbutyl)piperazin-1-yl]pentanethioamide (PubChem CID 103033744) has the molecular formula C15H31N3OS and a molecular weight of 301.50 g/mol. Its IUPAC name is 2-[4-(3-methoxy-3-methylbutyl)piperazin-1-yl]pentanethioamide.
| Compound Name | 2-[4-(3-methoxy-3-methylbutyl)piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 103033744 |
| Molecular Formula | C15H31N3OS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 2-[4-(3-methoxy-3-methylbutyl)piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(CCC(C)(C)OC)CC1 |
| InChI | InChI=1S/C15H31N3OS/c1-5-6-13(14(16)20)18-11-9-17(10-12-18)8-7-15(2,3)19-4/h13H,5-12H2,1-4H3,(H2,16,20) |
| InChIKey | ICZBSLBTGSKXJP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|