C17H27N3S — CID 63341932
2-[4-(2-phenylethyl)piperazin-1-yl]pentanethioamide (PubChem CID 63341932) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 2-[4-(2-phenylethyl)piperazin-1-yl]pentanethioamide.
| Compound Name | 2-[4-(2-phenylethyl)piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 63341932 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-[4-(2-phenylethyl)piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3S/c1-2-6-16(17(18)21)20-13-11-19(12-14-20)10-9-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14H2,1H3,(H2,18,21) |
| InChIKey | NPNRVIZDFRNOFQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|