C14H25N5S — CID 63341675
2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pentanethioamide (PubChem CID 63341675) has the molecular formula C14H25N5S and a molecular weight of 295.46 g/mol. Its IUPAC name is 2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pentanethioamide.
| Compound Name | 2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pentanethioamide |
|---|---|
| PubChem CID | 63341675 |
| Molecular Formula | C14H25N5S |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(Cc2cnn(C)c2)CC1 |
| InChI | InChI=1S/C14H25N5S/c1-3-4-13(14(15)20)19-7-5-18(6-8-19)11-12-9-16-17(2)10-12/h9-10,13H,3-8,11H2,1-2H3,(H2,15,20) |
| InChIKey | RCBIQJBVSBPGEQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|