C15H31N5S — CID 82888621
2-[4-[2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butanethioamide (PubChem CID 82888621) has the molecular formula C15H31N5S and a molecular weight of 313.52 g/mol. Its IUPAC name is 2-[4-[2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-[2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 82888621 |
| Molecular Formula | C15H31N5S |
| Molecular Weight | 313.52 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 2-[4-[2-(4-methylpiperazin-1-yl)ethyl]piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(CCN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C15H31N5S/c1-3-14(15(16)21)20-12-10-19(11-13-20)9-8-18-6-4-17(2)5-7-18/h14H,3-13H2,1-2H3,(H2,16,21) |
| InChIKey | CHNULXPVXXYWJH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.52 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|