C10H22N4O2S2 — CID 55203141
2-[4-(dimethylsulfamoyl)piperazin-1-yl]butanethioamide (PubChem CID 55203141) has the molecular formula C10H22N4O2S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 55203141 |
| Molecular Formula | C10H22N4O2S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C10H22N4O2S2/c1-4-9(10(11)17)13-5-7-14(8-6-13)18(15,16)12(2)3/h9H,4-8H2,1-3H3,(H2,11,17) |
| InChIKey | VWCNNQLEUSZGQO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|