C12H20N4O2S3 — CID 103414679
2-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]butanethioamide (PubChem CID 103414679) has the molecular formula C12H20N4O2S3 and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 103414679 |
| Molecular Formula | C12H20N4O2S3 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(S(=O)(=O)c2cnc(C)s2)CC1 |
| InChI | InChI=1S/C12H20N4O2S3/c1-3-10(12(13)19)15-4-6-16(7-5-15)21(17,18)11-8-14-9(2)20-11/h8,10H,3-7H2,1-2H3,(H2,13,19) |
| InChIKey | GPSSFKFCNDUKIP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|