C8H11ClN2O2S2 — CID 103415890
5-(3-chloropyrrolidin-1-yl)sulfonyl-2-methyl-1,3-thiazole (PubChem CID 103415890) has the molecular formula C8H11ClN2O2S2 and a molecular weight of 266.77 g/mol. Its IUPAC name is 5-(3-chloropyrrolidin-1-yl)sulfonyl-2-methyl-1,3-thiazole.
| Compound Name | 5-(3-chloropyrrolidin-1-yl)sulfonyl-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 103415890 |
| Molecular Formula | C8H11ClN2O2S2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 5-(3-chloropyrrolidin-1-yl)sulfonyl-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc(S(=O)(=O)N2CCC(Cl)C2)s1 |
| InChI | InChI=1S/C8H11ClN2O2S2/c1-6-10-4-8(14-6)15(12,13)11-3-2-7(9)5-11/h4,7H,2-3,5H2,1H3 |
| InChIKey | OYPGPIDQPQBGSJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|