C9H14N2O3S2 — CID 103847906
1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol (PubChem CID 103847906) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol.
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol |
|---|---|
| PubChem CID | 103847906 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol |
| SMILES | Cc1ncc(S(=O)(=O)N2CCCC(O)C2)s1 |
| InChI | InChI=1S/C9H14N2O3S2/c1-7-10-5-9(15-7)16(13,14)11-4-2-3-8(12)6-11/h5,8,12H,2-4,6H2,1H3 |
| InChIKey | DKDKCOSQFXEVJY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |