C8H11ClN2O3S2 — CID 107877932
(3S)-1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol (PubChem CID 107877932) has the molecular formula C8H11ClN2O3S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is (3S)-1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol |
|---|---|
| PubChem CID | 107877932 |
| Molecular Formula | C8H11ClN2O3S2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | (3S)-1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-3-ol |
| SMILES | O=S(=O)(c1cnc(Cl)s1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C8H11ClN2O3S2/c9-8-10-4-7(15-8)16(13,14)11-3-1-2-6(12)5-11/h4,6,12H,1-3,5H2/t6-/m0/s1 |
| InChIKey | VSBYNXQXLFLROG-LURJTMIESA-N |
| XLogP | 0.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |