C8H11ClN2O2S3 — CID 61419635
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-1,4-thiazepane (PubChem CID 61419635) has the molecular formula C8H11ClN2O2S3 and a molecular weight of 298.84 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-1,4-thiazepane.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 61419635 |
| Molecular Formula | C8H11ClN2O2S3 |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]-1,4-thiazepane |
| SMILES | O=S(=O)(c1cnc(Cl)s1)N1CCCSCC1 |
| InChI | InChI=1S/C8H11ClN2O2S3/c9-8-10-6-7(15-8)16(12,13)11-2-1-4-14-5-3-11/h6H,1-5H2 |
| InChIKey | MZLRLXSUZJMWQN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |