C7H8ClN3O3S2 — CID 43427528
4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperazin-2-one (PubChem CID 43427528) has the molecular formula C7H8ClN3O3S2 and a molecular weight of 281.75 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperazin-2-one.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperazin-2-one |
|---|---|
| PubChem CID | 43427528 |
| Molecular Formula | C7H8ClN3O3S2 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cnc(Cl)s2)CCN1 |
| InChI | InChI=1S/C7H8ClN3O3S2/c8-7-10-3-6(15-7)16(13,14)11-2-1-9-5(12)4-11/h3H,1-2,4H2,(H,9,12) |
| InChIKey | DHJVGYJIFKIDFA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |