C6H7ClN2O3S2 — CID 22245084
2-(acetamidomethyl)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 22245084) has the molecular formula C6H7ClN2O3S2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-(acetamidomethyl)-1,3-thiazole-5-sulfonyl chloride.
| Compound Name | 2-(acetamidomethyl)-1,3-thiazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 22245084 |
| Molecular Formula | C6H7ClN2O3S2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-(acetamidomethyl)-1,3-thiazole-5-sulfonyl chloride |
| SMILES | CC(=O)NCc1ncc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C6H7ClN2O3S2/c1-4(10)8-2-5-9-3-6(13-5)14(7,11)12/h3H,2H2,1H3,(H,8,10) |
| InChIKey | DCORQHIEPDKUDQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |