C10H15ClN2O2S2 — CID 43455811
2-chloro-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole (PubChem CID 43455811) has the molecular formula C10H15ClN2O2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-chloro-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole.
| Compound Name | 2-chloro-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 43455811 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-chloro-5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cnc(Cl)s2)C1 |
| InChI | InChI=1S/C10H15ClN2O2S2/c1-7-3-8(2)6-13(5-7)17(14,15)9-4-12-10(11)16-9/h4,7-8H,3,5-6H2,1-2H3 |
| InChIKey | AYMXBLHEVUIHPT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |