C9H15N3O3S2 — CID 126422400
5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-1,3-thiazol-2-amine (PubChem CID 126422400) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 126422400 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-1,3-thiazol-2-amine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cnc(N)s2)C[C@H](C)O1 |
| InChI | InChI=1S/C9H15N3O3S2/c1-6-4-12(5-7(2)15-6)17(13,14)8-3-11-9(10)16-8/h3,6-7H,4-5H2,1-2H3,(H2,10,11)/t6-,7-/m0/s1 |
| InChIKey | VRBXSLRRGAAXFH-BQBZGAKWSA-N |
| XLogP | 0.52 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |