C12H18N2O5S2 — CID 788068
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzenesulfonamide (PubChem CID 788068) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzenesulfonamide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 788068 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-9-7-14(8-10(2)19-9)21(17,18)12-5-3-11(4-6-12)20(13,15)16/h3-6,9-10H,7-8H2,1-2H3,(H2,13,15,16)/t9-,10-/m0/s1 |
| InChIKey | IMHLKDJRXNWNNP-UWVGGRQHSA-N |
| XLogP | 0.13 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |