C13H18BrNO3S — CID 65482577
4-[4-(bromomethyl)phenyl]sulfonyl-2,6-dimethylmorpholine (PubChem CID 65482577) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 4-[4-(bromomethyl)phenyl]sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-[4-(bromomethyl)phenyl]sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 65482577 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-[4-(bromomethyl)phenyl]sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(CBr)cc2)CC(C)O1 |
| InChI | InChI=1S/C13H18BrNO3S/c1-10-8-15(9-11(2)18-10)19(16,17)13-5-3-12(7-14)4-6-13/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | SXGPAXOAKPZYAR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|