C18H27NO3S — CID 2932492
4-(4-cyclohexylphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 2932492) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(4-cyclohexylphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2932492 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-(4-cyclohexylphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H27NO3S/c1-14-12-19(13-15(2)22-14)23(20,21)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h8-11,14-16H,3-7,12-13H2,1-2H3 |
| InChIKey | QBWOAWBMDYYGON-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |