C13H19NO4S — CID 2851611
4-(4-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 2851611) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2851611 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-10-8-14(9-11(2)18-10)19(15,16)13-6-4-12(17-3)5-7-13/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | SONKSHWXWHWISY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |