C18H21NO3S — CID 3274124
2,6-dimethyl-4-(4-phenylphenyl)sulfonylmorpholine (PubChem CID 3274124) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-phenylphenyl)sulfonylmorpholine.
| Compound Name | 2,6-dimethyl-4-(4-phenylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 3274124 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,6-dimethyl-4-(4-phenylphenyl)sulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(-c3ccccc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H21NO3S/c1-14-12-19(13-15(2)22-14)23(20,21)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | NDLPIVRSBPVHMK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |