C16H19NO3S — CID 704067
(2S,6S)-2,6-dimethyl-4-naphthalen-2-ylsulfonylmorpholine (PubChem CID 704067) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-naphthalen-2-ylsulfonylmorpholine.
| Compound Name | (2S,6S)-2,6-dimethyl-4-naphthalen-2-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 704067 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-naphthalen-2-ylsulfonylmorpholine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc3ccccc3c2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H19NO3S/c1-12-10-17(11-13(2)20-12)21(18,19)16-8-7-14-5-3-4-6-15(14)9-16/h3-9,12-13H,10-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | ZFDCCSJSPIQLSH-STQMWFEESA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |