C12H15F2NO3S — CID 2142612
(2R,6S)-4-(3,4-difluorophenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 2142612) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is (2R,6S)-4-(3,4-difluorophenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(3,4-difluorophenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 2142612 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2R,6S)-4-(3,4-difluorophenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(F)c(F)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H15F2NO3S/c1-8-6-15(7-9(2)18-8)19(16,17)10-3-4-11(13)12(14)5-10/h3-5,8-9H,6-7H2,1-2H3/t8-,9+ |
| InChIKey | ZEIFFRJUOXPPPC-DTORHVGOSA-N |
| XLogP | 1.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |