C12H17FN2O3S — CID 82844225
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-2-fluoroaniline (PubChem CID 82844225) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-2-fluoroaniline.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-2-fluoroaniline |
|---|---|
| PubChem CID | 82844225 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-2-fluoroaniline |
| SMILES | CC1CN(S(=O)(=O)c2ccc(N)c(F)c2)CC(C)O1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-8-6-15(7-9(2)18-8)19(16,17)10-3-4-12(14)11(13)5-10/h3-5,8-9H,6-7,14H2,1-2H3 |
| InChIKey | BGCAZZLSHHAMEG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|