C13H19FN2O3S — CID 104957721
5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-fluoro-4-methylaniline (PubChem CID 104957721) has the molecular formula C13H19FN2O3S and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-fluoro-4-methylaniline.
| Compound Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-fluoro-4-methylaniline |
|---|---|
| PubChem CID | 104957721 |
| Molecular Formula | C13H19FN2O3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-2-fluoro-4-methylaniline |
| SMILES | Cc1cc(F)c(N)cc1S(=O)(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H19FN2O3S/c1-8-4-11(14)12(15)5-13(8)20(17,18)16-6-9(2)19-10(3)7-16/h4-5,9-10H,6-7,15H2,1-3H3/t9-,10+ |
| InChIKey | TZIVCCMTTQEFER-AOOOYVTPSA-N |
| XLogP | 1.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|