C13H17Br2NO3S — CID 103931355
(2S,6R)-4-(2,5-dibromo-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 103931355) has the molecular formula C13H17Br2NO3S and a molecular weight of 427.16 g/mol. Its IUPAC name is (2S,6R)-4-(2,5-dibromo-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(2,5-dibromo-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 103931355 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | (2S,6R)-4-(2,5-dibromo-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1Br |
| InChI | InChI=1S/C13H17Br2NO3S/c1-8-4-12(15)13(5-11(8)14)20(17,18)16-6-9(2)19-10(3)7-16/h4-5,9-10H,6-7H2,1-3H3/t9-,10+ |
| InChIKey | KWHNDDCYOLRFKH-AOOOYVTPSA-N |
| XLogP | 3.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |