C14H20BrNO5S — CID 9185861
(2R,6R)-4-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 9185861) has the molecular formula C14H20BrNO5S and a molecular weight of 394.29 g/mol. Its IUPAC name is (2R,6R)-4-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 9185861 |
| Molecular Formula | C14H20BrNO5S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | (2R,6R)-4-(2-bromo-4,5-dimethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | COc1cc(Br)c(S(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)cc1OC |
| InChI | InChI=1S/C14H20BrNO5S/c1-9-7-16(8-10(2)21-9)22(17,18)14-6-13(20-4)12(19-3)5-11(14)15/h5-6,9-10H,7-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | HXKBGEJYMWRGKQ-NXEZZACHSA-N |
| XLogP | 2.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |