C17H27NO5S — CID 6460147
4-(2,5-diethoxy-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 6460147) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-(2,5-diethoxy-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(2,5-diethoxy-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 6460147 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-(2,5-diethoxy-4-methylphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CCOc1cc(S(=O)(=O)N2CC(C)OC(C)C2)c(OCC)cc1C |
| InChI | InChI=1S/C17H27NO5S/c1-6-21-15-9-17(16(22-7-2)8-12(15)3)24(19,20)18-10-13(4)23-14(5)11-18/h8-9,13-14H,6-7,10-11H2,1-5H3 |
| InChIKey | HBLBLZKAOHDCBY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |