C16H25NO5S — CID 9185875
(2R,6R)-4-(3,4-diethoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 9185875) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2R,6R)-4-(3,4-diethoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-(3,4-diethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 9185875 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (2R,6R)-4-(3,4-diethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CCOc1ccc(S(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)cc1OCC |
| InChI | InChI=1S/C16H25NO5S/c1-5-20-15-8-7-14(9-16(15)21-6-2)23(18,19)17-10-12(3)22-13(4)11-17/h7-9,12-13H,5-6,10-11H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | YRKBXEOBUOKMCD-CHWSQXEVSA-N |
| XLogP | 2.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |