C19H31NO4S — CID 95864977
(3S,5S)-1-(3,4-dipropoxyphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 95864977) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is (3S,5S)-1-(3,4-dipropoxyphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(3,4-dipropoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 95864977 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (3S,5S)-1-(3,4-dipropoxyphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)cc1OCCC |
| InChI | InChI=1S/C19H31NO4S/c1-5-9-23-18-8-7-17(12-19(18)24-10-6-2)25(21,22)20-13-15(3)11-16(4)14-20/h7-8,12,15-16H,5-6,9-11,13-14H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | MMXZBGXQBVIRHF-HOTGVXAUSA-N |
| XLogP | 3.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |