C16H25NO3S — CID 2294126
(3S,5S)-3,5-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidine (PubChem CID 2294126) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidine.
| Compound Name | (3S,5S)-3,5-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 2294126 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)cc1 |
| InChI | InChI=1S/C16H25NO3S/c1-4-9-20-15-5-7-16(8-6-15)21(18,19)17-11-13(2)10-14(3)12-17/h5-8,13-14H,4,9-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | WPQQFCIHAQLNLG-KBPBESRZSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |