C14H21NO4S — CID 62371705
[1-(4-propoxyphenyl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 62371705) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is [1-(4-propoxyphenyl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(4-propoxyphenyl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 62371705 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [1-(4-propoxyphenyl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(CO)C2)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-2-9-19-13-3-5-14(6-4-13)20(17,18)15-8-7-12(10-15)11-16/h3-6,12,16H,2,7-11H2,1H3 |
| InChIKey | BYGFBXFCUNTNCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |