C16H26N2O3S — CID 120779463
3,3-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidin-4-amine (PubChem CID 120779463) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779463 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3,3-dimethyl-1-(4-propoxyphenyl)sulfonylpiperidin-4-amine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(N)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-4-11-21-13-5-7-14(8-6-13)22(19,20)18-10-9-15(17)16(2,3)12-18/h5-8,15H,4,9-12,17H2,1-3H3 |
| InChIKey | WSBNEBUEKCOUSY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |