C18H30N2O3S — CID 120779320
3,3-dimethyl-1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-4-amine (PubChem CID 120779320) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779320 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3,3-dimethyl-1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-4-amine |
| SMILES | CC(C)CCOc1ccc(S(=O)(=O)N2CCC(N)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H30N2O3S/c1-14(2)10-12-23-15-5-7-16(8-6-15)24(21,22)20-11-9-17(19)18(3,4)13-20/h5-8,14,17H,9-13,19H2,1-4H3 |
| InChIKey | OWYQTCAYHQAOSI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |