C14H23ClN2O3S — CID 119959067
1-(4-propoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959067) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 1-(4-propoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-(4-propoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959067 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(4-propoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(N)CC2)cc1.Cl |
| InChI | InChI=1S/C14H22N2O3S.ClH/c1-2-11-19-13-3-5-14(6-4-13)20(17,18)16-9-7-12(15)8-10-16;/h3-6,12H,2,7-11,15H2,1H3;1H |
| InChIKey | JLSGAAADNUFBDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |