C17H27ClN2O3S — CID 120583995
2-(4-propoxyphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120583995) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is 2-(4-propoxyphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(4-propoxyphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120583995 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(4-propoxyphenyl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CC3CCCC(N)C3C2)cc1.Cl |
| InChI | InChI=1S/C17H26N2O3S.ClH/c1-2-10-22-14-6-8-15(9-7-14)23(20,21)19-11-13-4-3-5-17(18)16(13)12-19;/h6-9,13,16-17H,2-5,10-12,18H2,1H3;1H |
| InChIKey | CVRWONUSJGDTQC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |