C14H23ClN2O2S2 — CID 120583874
2-(5-ethylthiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120583874) has the molecular formula C14H23ClN2O2S2 and a molecular weight of 350.94 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(5-ethylthiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120583874 |
| Molecular Formula | C14H23ClN2O2S2 |
| Molecular Weight | 350.94 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | CCc1ccc(S(=O)(=O)N2CC3CCCC(N)C3C2)s1.Cl |
| InChI | InChI=1S/C14H22N2O2S2.ClH/c1-2-11-6-7-14(19-11)20(17,18)16-8-10-4-3-5-13(15)12(10)9-16;/h6-7,10,12-13H,2-5,8-9,15H2,1H3;1H |
| InChIKey | MKTGOHWAZPJIET-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |