C14H25ClN4O2S — CID 120583929
2-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120583929) has the molecular formula C14H25ClN4O2S and a molecular weight of 348.90 g/mol. Its IUPAC name is 2-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120583929 |
| Molecular Formula | C14H25ClN4O2S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(1-ethyl-2-methylimidazol-4-yl)sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | CCn1cc(S(=O)(=O)N2CC3CCCC(N)C3C2)nc1C.Cl |
| InChI | InChI=1S/C14H24N4O2S.ClH/c1-3-17-9-14(16-10(17)2)21(19,20)18-7-11-5-4-6-13(15)12(11)8-18;/h9,11-13H,3-8,15H2,1-2H3;1H |
| InChIKey | OYRSNMUOKNQTDP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |